C16H15N3O7 — CID 580265
N-[2-(3-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide (PubChem CID 580265) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 580265 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]-3,5-dinitrobenzamide |
| SMILES | COc1cccc(OCCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H15N3O7/c1-25-14-3-2-4-15(10-14)26-6-5-17-16(20)11-7-12(18(21)22)9-13(8-11)19(23)24/h2-4,7-10H,5-6H2,1H3,(H,17,20) |
| InChIKey | UHGLMYOSMOEXLV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|