C14H15N5O4 — CID 133467918
3-methoxy-N-[2-[(5-nitropyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 133467918) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(5-nitropyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[(5-nitropyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133467918 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-methoxy-N-[2-[(5-nitropyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCNc2ncc([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C14H15N5O4/c1-23-12-4-2-3-10(7-12)13(20)15-5-6-16-14-17-8-11(9-18-14)19(21)22/h2-4,7-9H,5-6H2,1H3,(H,15,20)(H,16,17,18) |
| InChIKey | CNBBCTJDMQGYRI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|