C17H23N5O2 — CID 70702840
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide (PubChem CID 70702840) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 70702840 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-methoxybenzamide |
| SMILES | CCNc1nc(C)cc(NCCNC(=O)c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-4-18-17-21-12(2)10-15(22-17)19-8-9-20-16(23)13-6-5-7-14(11-13)24-3/h5-7,10-11H,4,8-9H2,1-3H3,(H,20,23)(H2,18,19,21,22) |
| InChIKey | LHMSEOPRVCSPIE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|