C20H22N2O7 — CID 9022612
ethyl 3-[2-(4-ethoxyphenoxy)ethylcarbamoyl]-5-nitrobenzoate (PubChem CID 9022612) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is ethyl 3-[2-(4-ethoxyphenoxy)ethylcarbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[2-(4-ethoxyphenoxy)ethylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 9022612 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | ethyl 3-[2-(4-ethoxyphenoxy)ethylcarbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)NCCOc2ccc(OCC)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N2O7/c1-3-27-17-5-7-18(8-6-17)29-10-9-21-19(23)14-11-15(20(24)28-4-2)13-16(12-14)22(25)26/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,21,23) |
| InChIKey | VECVQAVSXWDVEP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|