C32H35N3O6 — CID 3900364
5-nitro-1-N,3-N-bis[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzene-1,3-dicarboxamide (PubChem CID 3900364) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is 5-nitro-1-N,3-N-bis[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-nitro-1-N,3-N-bis[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3900364 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 5-nitro-1-N,3-N-bis[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)CCCC2)c1cc(C(=O)NCCOc2ccc3c(c2)CCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H35N3O6/c36-31(33-13-15-40-29-11-9-22-5-1-3-7-24(22)20-29)26-17-27(19-28(18-26)35(38)39)32(37)34-14-16-41-30-12-10-23-6-2-4-8-25(23)21-30/h9-12,17-21H,1-8,13-16H2,(H,33,36)(H,34,37) |
| InChIKey | FYQXJELATJOYCC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|