C20H23NO2 — CID 113101544
2-methyl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzamide (PubChem CID 113101544) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-methyl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzamide.
| Compound Name | 2-methyl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzamide |
|---|---|
| PubChem CID | 113101544 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-methyl-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H23NO2/c1-15-6-2-5-9-19(15)20(22)21-12-13-23-18-11-10-16-7-3-4-8-17(16)14-18/h2,5-6,9-11,14H,3-4,7-8,12-13H2,1H3,(H,21,22) |
| InChIKey | YXCDPBBZMPGVGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|