C21H21N3O2 — CID 55953672
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 55953672) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-5-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-5-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55953672 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)CCC2)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2/c25-21(19-14-23-24-20(19)16-5-2-1-3-6-16)22-11-12-26-18-10-9-15-7-4-8-17(15)13-18/h1-3,5-6,9-10,13-14H,4,7-8,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | IQIJYJWIWIELLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|