C21H23N3O2 — CID 55846230
N-[(3-butoxyphenyl)methyl]-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 55846230) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-5-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(3-butoxyphenyl)methyl]-5-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55846230 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | CCCCOc1cccc(CNC(=O)c2cn[nH]c2-c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-2-3-12-26-18-11-7-8-16(13-18)14-22-21(25)19-15-23-24-20(19)17-9-5-4-6-10-17/h4-11,13,15H,2-3,12,14H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | YLKFEICFMKOCDB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|