C23H27FN2O3 — CID 51966653
N-[(2S)-1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 51966653) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[(2S)-1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(2S)-1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 51966653 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(2S)-1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethylamino]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1F)C(=O)NCCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H27FN2O3/c1-15(2)21(26-22(27)19-8-3-4-9-20(19)24)23(28)25-12-13-29-18-11-10-16-6-5-7-17(16)14-18/h3-4,8-11,14-15,21H,5-7,12-13H2,1-2H3,(H,25,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | BFVDWSRTSMPCSC-NRFANRHFSA-N |
| XLogP | 3.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|