C19H19F3N2O2 — CID 112974787
1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 112974787) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 112974787 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCOc1ccc2c(c1)CCC2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O2/c20-19(21,22)16-6-1-2-7-17(16)24-18(25)23-10-11-26-15-9-8-13-4-3-5-14(13)12-15/h1-2,6-9,12H,3-5,10-11H2,(H2,23,24,25) |
| InChIKey | UGQUDMPHGUJEGJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|