C20H20ClN3O7 — CID 55878140
ethyl 3-[[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 55878140) has the molecular formula C20H20ClN3O7 and a molecular weight of 449.85 g/mol. Its IUPAC name is ethyl 3-[[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 55878140 |
| Molecular Formula | C20H20ClN3O7 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl 3-[[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(C(=O)NCCOC)c(Cl)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20ClN3O7/c1-3-31-20(27)13-8-12(9-15(10-13)24(28)29)18(25)23-14-4-5-16(17(21)11-14)19(26)22-6-7-30-2/h4-5,8-11H,3,6-7H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | MREFCRILHGDUBM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|