C17H17N3O7S — CID 46809534
ethyl 3-[(4-methyl-3-sulfamoylphenyl)carbamoyl]-5-nitrobenzoate (PubChem CID 46809534) has the molecular formula C17H17N3O7S and a molecular weight of 407.40 g/mol. Its IUPAC name is ethyl 3-[(4-methyl-3-sulfamoylphenyl)carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[(4-methyl-3-sulfamoylphenyl)carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 46809534 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | ethyl 3-[(4-methyl-3-sulfamoylphenyl)carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(C)c(S(N)(=O)=O)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O7S/c1-3-27-17(22)12-6-11(7-14(8-12)20(23)24)16(21)19-13-5-4-10(2)15(9-13)28(18,25)26/h4-9H,3H2,1-2H3,(H,19,21)(H2,18,25,26) |
| InChIKey | ICYHYFAYNILWHZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|