C22H25N3O8S — CID 26174256
ethyl 3-[(4-methoxy-3-piperidin-1-ylsulfonylphenyl)carbamoyl]-5-nitrobenzoate (PubChem CID 26174256) has the molecular formula C22H25N3O8S and a molecular weight of 491.52 g/mol. Its IUPAC name is ethyl 3-[(4-methoxy-3-piperidin-1-ylsulfonylphenyl)carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[(4-methoxy-3-piperidin-1-ylsulfonylphenyl)carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 26174256 |
| Molecular Formula | C22H25N3O8S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | ethyl 3-[(4-methoxy-3-piperidin-1-ylsulfonylphenyl)carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(OC)c(S(=O)(=O)N3CCCCC3)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N3O8S/c1-3-33-22(27)16-11-15(12-18(13-16)25(28)29)21(26)23-17-7-8-19(32-2)20(14-17)34(30,31)24-9-5-4-6-10-24/h7-8,11-14H,3-6,9-10H2,1-2H3,(H,23,26) |
| InChIKey | WTPNVNSNQYOLFQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|