C18H23N5O6S — CID 55568502
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 55568502) has the molecular formula C18H23N5O6S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 55568502 |
| Molecular Formula | C18H23N5O6S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1ccc(NC(=O)CCn2cc([N+](=O)[O-])cn2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H23N5O6S/c1-29-16-6-5-14(11-17(16)30(27,28)22-8-3-2-4-9-22)20-18(24)7-10-21-13-15(12-19-21)23(25)26/h5-6,11-13H,2-4,7-10H2,1H3,(H,20,24) |
| InChIKey | CHPFYQBCNCMSEX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|