C19H16F3N3O6 — CID 18290874
ethyl 3-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoyl]-5-nitrobenzoate (PubChem CID 18290874) has the molecular formula C19H16F3N3O6 and a molecular weight of 439.35 g/mol. Its IUPAC name is ethyl 3-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoyl]-5-nitrobenzoate.
| Compound Name | ethyl 3-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 18290874 |
| Molecular Formula | C19H16F3N3O6 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | ethyl 3-[[4-acetamido-2-(trifluoromethyl)phenyl]carbamoyl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(NC(C)=O)cc2C(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F3N3O6/c1-3-31-18(28)12-6-11(7-14(8-12)25(29)30)17(27)24-16-5-4-13(23-10(2)26)9-15(16)19(20,21)22/h4-9H,3H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | ZYCVNWFLAYLFIB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|