C12H11F3N2O5 — CID 43008403
ethyl 3-nitro-5-(2,2,2-trifluoroethylcarbamoyl)benzoate (PubChem CID 43008403) has the molecular formula C12H11F3N2O5 and a molecular weight of 320.22 g/mol. Its IUPAC name is ethyl 3-nitro-5-(2,2,2-trifluoroethylcarbamoyl)benzoate.
| Compound Name | ethyl 3-nitro-5-(2,2,2-trifluoroethylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 43008403 |
| Molecular Formula | C12H11F3N2O5 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl 3-nitro-5-(2,2,2-trifluoroethylcarbamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(=O)NCC(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11F3N2O5/c1-2-22-11(19)8-3-7(4-9(5-8)17(20)21)10(18)16-6-12(13,14)15/h3-5H,2,6H2,1H3,(H,16,18) |
| InChIKey | DTSFUYUHHKCFPH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|