C9H8F3N3O5S — CID 65374277
3-nitro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 65374277) has the molecular formula C9H8F3N3O5S and a molecular weight of 327.24 g/mol. Its IUPAC name is 3-nitro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-nitro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 65374277 |
| Molecular Formula | C9H8F3N3O5S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-nitro-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8F3N3O5S/c10-9(11,12)4-14-8(16)5-1-6(15(17)18)3-7(2-5)21(13,19)20/h1-3H,4H2,(H,14,16)(H2,13,19,20) |
| InChIKey | SIQNOQDRNUMYDN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|