C18H18F3NO4 — CID 30350054
3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide (PubChem CID 30350054) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 30350054 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3,5-dimethoxy-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCOc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H18F3NO4/c1-24-15-8-12(9-16(11-15)25-2)17(23)22-6-7-26-14-5-3-4-13(10-14)18(19,20)21/h3-5,8-11H,6-7H2,1-2H3,(H,22,23) |
| InChIKey | VSSFJTZQCAZHQZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|