C24H21Cl2N3O6 — CID 3710842
1-N,3-N-bis[2-(2-chlorophenoxy)ethyl]-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 3710842) has the molecular formula C24H21Cl2N3O6 and a molecular weight of 518.35 g/mol. Its IUPAC name is 1-N,3-N-bis[2-(2-chlorophenoxy)ethyl]-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[2-(2-chlorophenoxy)ethyl]-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3710842 |
| Molecular Formula | C24H21Cl2N3O6 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 1-N,3-N-bis[2-(2-chlorophenoxy)ethyl]-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | O=C(NCCOc1ccccc1Cl)c1cc(C(=O)NCCOc2ccccc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21Cl2N3O6/c25-19-5-1-3-7-21(19)34-11-9-27-23(30)16-13-17(15-18(14-16)29(32)33)24(31)28-10-12-35-22-8-4-2-6-20(22)26/h1-8,13-15H,9-12H2,(H,27,30)(H,28,31) |
| InChIKey | LMHHUDFCDWBFOS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|