C9H8BrClF2N2O — CID 99834350
1-(2-bromo-3-chlorophenyl)-3-(2,2-difluoroethyl)urea (PubChem CID 99834350) has the molecular formula C9H8BrClF2N2O and a molecular weight of 313.53 g/mol. Its IUPAC name is 1-(2-bromo-3-chlorophenyl)-3-(2,2-difluoroethyl)urea.
| Compound Name | 1-(2-bromo-3-chlorophenyl)-3-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 99834350 |
| Molecular Formula | C9H8BrClF2N2O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-(2-bromo-3-chlorophenyl)-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C9H8BrClF2N2O/c10-8-5(11)2-1-3-6(8)15-9(16)14-4-7(12)13/h1-3,7H,4H2,(H2,14,15,16) |
| InChIKey | IZABCAMRRULUEU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |