2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid

C11H12F2N2O3 — CID 113303927

IUPAC2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid
SMILESCc1cccc(NC(=O)NCC(F)F)c1C(=O)O
InChIInChI=1S/C11H12F2N2O3/c1-6-3-2-4-7(9(6)10(16)17)15-11(18)14-5-8(12)13/h2-4,8H,5H2,1H3,(H,16,17)(H2,14,15,18)
InChIKeyXXRNBJQYJLKJCP-UHFFFAOYSA-N
MW258.22 g/mol
LogP2.08
Rot. Bonds4

About 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid

2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid (PubChem CID 113303927) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid.

Molecular Properties

Compound Name2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid
PubChem CID113303927
Molecular FormulaC11H12F2N2O3
Molecular Weight258.22 g/mol
Exact Mass258.08
IUPAC Name2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid
SMILESCc1cccc(NC(=O)NCC(F)F)c1C(=O)O
InChIInChI=1S/C11H12F2N2O3/c1-6-3-2-4-7(9(6)10(16)17)15-11(18)14-5-8(12)13/h2-4,8H,5H2,1H3,(H,16,17)(H2,14,15,18)
InChIKeyXXRNBJQYJLKJCP-UHFFFAOYSA-N
XLogP2.08
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.22
LogP ≤ 52.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid?
The IUPAC name of 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid (CID 113303927) is 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid.
What is the SMILES notation for 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid?
The canonical SMILES for 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid is Cc1cccc(NC(=O)NCC(F)F)c1C(=O)O.
What is the InChIKey of 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid?
The InChIKey is XXRNBJQYJLKJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O3/c1-6-3-2-4-7(9(6)10(16)17)15-11(18)14-5-8(12)13/h2-4,8H,5H2,1H3,(H,16,17)(H2,14,15,18).
What are the key properties of 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid?
2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid has a molecular weight of 258.22 g/mol, XLogP of 2.08, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylcarbamoylamino)-6-methylbenzoic acid is sourced from PubChem (CID 113303927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).