C12H11ClN4O3 — CID 64525317
2-chloro-6-(1H-imidazol-2-ylmethylcarbamoylamino)benzoic acid (PubChem CID 64525317) has the molecular formula C12H11ClN4O3 and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-chloro-6-(1H-imidazol-2-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-chloro-6-(1H-imidazol-2-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 64525317 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-chloro-6-(1H-imidazol-2-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ncc[nH]1)Nc1cccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C12H11ClN4O3/c13-7-2-1-3-8(10(7)11(18)19)17-12(20)16-6-9-14-4-5-15-9/h1-5H,6H2,(H,14,15)(H,18,19)(H2,16,17,20) |
| InChIKey | TVSKPCPNDZJXDL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |