C17H13F3N4O — CID 75438861
1-(1H-imidazol-2-ylmethyl)-3-[2-(3,4,5-trifluorophenyl)phenyl]urea (PubChem CID 75438861) has the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylmethyl)-3-[2-(3,4,5-trifluorophenyl)phenyl]urea.
| Compound Name | 1-(1H-imidazol-2-ylmethyl)-3-[2-(3,4,5-trifluorophenyl)phenyl]urea |
|---|---|
| PubChem CID | 75438861 |
| Molecular Formula | C17H13F3N4O |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(1H-imidazol-2-ylmethyl)-3-[2-(3,4,5-trifluorophenyl)phenyl]urea |
| SMILES | O=C(NCc1ncc[nH]1)Nc1ccccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H13F3N4O/c18-12-7-10(8-13(19)16(12)20)11-3-1-2-4-14(11)24-17(25)23-9-15-21-5-6-22-15/h1-8H,9H2,(H,21,22)(H2,23,24,25) |
| InChIKey | LUKPCLXZSBXKFT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|