C11H10F2N4O — CID 75389672
1-(3,5-difluorophenyl)-3-(1H-imidazol-2-ylmethyl)urea (PubChem CID 75389672) has the molecular formula C11H10F2N4O and a molecular weight of 252.22 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(1H-imidazol-2-ylmethyl)urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-(1H-imidazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 75389672 |
| Molecular Formula | C11H10F2N4O |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(1H-imidazol-2-ylmethyl)urea |
| SMILES | O=C(NCc1ncc[nH]1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H10F2N4O/c12-7-3-8(13)5-9(4-7)17-11(18)16-6-10-14-1-2-15-10/h1-5H,6H2,(H,14,15)(H2,16,17,18) |
| InChIKey | ZMMRTEKQJNIWCL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |