C12H14N2O5 — CID 113458409
3-(2-acetamidopropanoylamino)-2-hydroxybenzoic acid (PubChem CID 113458409) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-(2-acetamidopropanoylamino)-2-hydroxybenzoic acid.
| Compound Name | 3-(2-acetamidopropanoylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 113458409 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-(2-acetamidopropanoylamino)-2-hydroxybenzoic acid |
| SMILES | CC(=O)NC(C)C(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C12H14N2O5/c1-6(13-7(2)15)11(17)14-9-5-3-4-8(10(9)16)12(18)19/h3-6,16H,1-2H3,(H,13,15)(H,14,17)(H,18,19) |
| InChIKey | QUKWIXKHLPVWJQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|