C12H15BrN2O5S — CID 63113661
3-bromo-2-(3-methylsulfonylpropylcarbamoylamino)benzoic acid (PubChem CID 63113661) has the molecular formula C12H15BrN2O5S and a molecular weight of 379.23 g/mol. Its IUPAC name is 3-bromo-2-(3-methylsulfonylpropylcarbamoylamino)benzoic acid.
| Compound Name | 3-bromo-2-(3-methylsulfonylpropylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63113661 |
| Molecular Formula | C12H15BrN2O5S |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 3-bromo-2-(3-methylsulfonylpropylcarbamoylamino)benzoic acid |
| SMILES | CS(=O)(=O)CCCNC(=O)Nc1c(Br)cccc1C(=O)O |
| InChI | InChI=1S/C12H15BrN2O5S/c1-21(19,20)7-3-6-14-12(18)15-10-8(11(16)17)4-2-5-9(10)13/h2,4-5H,3,6-7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | TTWPIMQMBCPMEQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|