C14H18Br2N2O3 — CID 107601826
7-[(2,6-dibromophenyl)carbamoylamino]heptanoic acid (PubChem CID 107601826) has the molecular formula C14H18Br2N2O3 and a molecular weight of 422.12 g/mol. Its IUPAC name is 7-[(2,6-dibromophenyl)carbamoylamino]heptanoic acid.
| Compound Name | 7-[(2,6-dibromophenyl)carbamoylamino]heptanoic acid |
|---|---|
| PubChem CID | 107601826 |
| Molecular Formula | C14H18Br2N2O3 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 7-[(2,6-dibromophenyl)carbamoylamino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C14H18Br2N2O3/c15-10-6-5-7-11(16)13(10)18-14(21)17-9-4-2-1-3-8-12(19)20/h5-7H,1-4,8-9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | ALYAMPCWPYAAOG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|