C11H11Br3N2O3 — CID 61184998
4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid (PubChem CID 61184998) has the molecular formula C11H11Br3N2O3 and a molecular weight of 458.93 g/mol. Its IUPAC name is 4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 61184998 |
| Molecular Formula | C11H11Br3N2O3 |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 455.83 |
| IUPAC Name | 4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br3N2O3/c12-6-4-7(13)10(8(14)5-6)16-11(19)15-3-1-2-9(17)18/h4-5H,1-3H2,(H,17,18)(H2,15,16,19) |
| InChIKey | MRHUAERZROXGIO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|