C12H16Br2N2O — CID 115569894
1-butyl-3-(2,6-dibromo-4-methylphenyl)urea (PubChem CID 115569894) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is 1-butyl-3-(2,6-dibromo-4-methylphenyl)urea.
| Compound Name | 1-butyl-3-(2,6-dibromo-4-methylphenyl)urea |
|---|---|
| PubChem CID | 115569894 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 1-butyl-3-(2,6-dibromo-4-methylphenyl)urea |
| SMILES | CCCCNC(=O)Nc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O/c1-3-4-5-15-12(17)16-11-9(13)6-8(2)7-10(11)14/h6-7H,3-5H2,1-2H3,(H2,15,16,17) |
| InChIKey | NXNJYVXHIIICIA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|