C16H26N2O2 — CID 127566183
1-(3-butoxypropyl)-3-(3,5-dimethylphenyl)urea (PubChem CID 127566183) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-(3-butoxypropyl)-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 127566183 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(3,5-dimethylphenyl)urea |
| SMILES | CCCCOCCCNC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-5-8-20-9-6-7-17-16(19)18-15-11-13(2)10-14(3)12-15/h10-12H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | QTPJJKVISQBHSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|