C14H23N3O2 — CID 115597711
3,5-diamino-N-(3-butoxypropyl)benzamide (PubChem CID 115597711) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3,5-diamino-N-(3-butoxypropyl)benzamide.
| Compound Name | 3,5-diamino-N-(3-butoxypropyl)benzamide |
|---|---|
| PubChem CID | 115597711 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3,5-diamino-N-(3-butoxypropyl)benzamide |
| SMILES | CCCCOCCCNC(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-3-6-19-7-4-5-17-14(18)11-8-12(15)10-13(16)9-11/h8-10H,2-7,15-16H2,1H3,(H,17,18) |
| InChIKey | MXAPVMSPWMCPMC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|