C15H23N3O2 — CID 171662867
5-amino-3-N,3-N-dimethyl-1-N-pentylbenzene-1,3-dicarboxamide (PubChem CID 171662867) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-amino-3-N,3-N-dimethyl-1-N-pentylbenzene-1,3-dicarboxamide.
| Compound Name | 5-amino-3-N,3-N-dimethyl-1-N-pentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 171662867 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 5-amino-3-N,3-N-dimethyl-1-N-pentylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cc(N)cc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H23N3O2/c1-4-5-6-7-17-14(19)11-8-12(10-13(16)9-11)15(20)18(2)3/h8-10H,4-7,16H2,1-3H3,(H,17,19) |
| InChIKey | ZRBWNTOFWMFHRW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|