C13H19F2N3O2 — CID 63186654
N-(2-butoxyethyl)-3,5-difluoro-4-hydrazinylbenzamide (PubChem CID 63186654) has the molecular formula C13H19F2N3O2 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2-butoxyethyl)-3,5-difluoro-4-hydrazinylbenzamide.
| Compound Name | N-(2-butoxyethyl)-3,5-difluoro-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 63186654 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(2-butoxyethyl)-3,5-difluoro-4-hydrazinylbenzamide |
| SMILES | CCCCOCCNC(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C13H19F2N3O2/c1-2-3-5-20-6-4-17-13(19)9-7-10(14)12(18-16)11(15)8-9/h7-8,18H,2-6,16H2,1H3,(H,17,19) |
| InChIKey | BMSPLKWDYLZIDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|