C11H14F2N4O2 — CID 63186049
N-(4-amino-4-oxobutyl)-3,5-difluoro-4-hydrazinylbenzamide (PubChem CID 63186049) has the molecular formula C11H14F2N4O2 and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-3,5-difluoro-4-hydrazinylbenzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-3,5-difluoro-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 63186049 |
| Molecular Formula | C11H14F2N4O2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-3,5-difluoro-4-hydrazinylbenzamide |
| SMILES | NNc1c(F)cc(C(=O)NCCCC(N)=O)cc1F |
| InChI | InChI=1S/C11H14F2N4O2/c12-7-4-6(5-8(13)10(7)17-15)11(19)16-3-1-2-9(14)18/h4-5,17H,1-3,15H2,(H2,14,18)(H,16,19) |
| InChIKey | NDESFFVCEKNRQS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|