C11H15F2N3O — CID 155067191
4-amino-N-(4-aminobutyl)-3,5-difluorobenzamide (PubChem CID 155067191) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-amino-N-(4-aminobutyl)-3,5-difluorobenzamide.
| Compound Name | 4-amino-N-(4-aminobutyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 155067191 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-amino-N-(4-aminobutyl)-3,5-difluorobenzamide |
| SMILES | NCCCCNC(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C11H15F2N3O/c12-8-5-7(6-9(13)10(8)15)11(17)16-4-2-1-3-14/h5-6H,1-4,14-15H2,(H,16,17) |
| InChIKey | UELYSEDUHOMVCT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|