C11H16ClN5O2 — CID 114162817
N-(5-amino-5-oxopentyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide (PubChem CID 114162817) has the molecular formula C11H16ClN5O2 and a molecular weight of 285.74 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(5-amino-5-oxopentyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114162817 |
| Molecular Formula | C11H16ClN5O2 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1cc(C(=O)NCCCCC(N)=O)cc(Cl)n1 |
| InChI | InChI=1S/C11H16ClN5O2/c12-8-5-7(6-10(16-8)17-14)11(19)15-4-2-1-3-9(13)18/h5-6H,1-4,14H2,(H2,13,18)(H,15,19)(H,16,17) |
| InChIKey | XWHSXOLZTCEFOQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|