C11H17ClN4O3 — CID 62236854
2-chloro-6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-4-carboxamide (PubChem CID 62236854) has the molecular formula C11H17ClN4O3 and a molecular weight of 288.74 g/mol. Its IUPAC name is 2-chloro-6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62236854 |
| Molecular Formula | C11H17ClN4O3 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-chloro-6-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]pyridine-4-carboxamide |
| SMILES | COCCOCCNC(=O)c1cc(Cl)nc(NN)c1 |
| InChI | InChI=1S/C11H17ClN4O3/c1-18-4-5-19-3-2-14-11(17)8-6-9(12)15-10(7-8)16-13/h6-7H,2-5,13H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | LPZVBTXTCZXTTO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|