C14H22ClN3O2 — CID 62178841
N-(2-butoxyethyl)-2-chloro-6-(ethylamino)pyridine-4-carboxamide (PubChem CID 62178841) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2-chloro-6-(ethylamino)pyridine-4-carboxamide.
| Compound Name | N-(2-butoxyethyl)-2-chloro-6-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62178841 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-(2-butoxyethyl)-2-chloro-6-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCCCOCCNC(=O)c1cc(Cl)nc(NCC)c1 |
| InChI | InChI=1S/C14H22ClN3O2/c1-3-5-7-20-8-6-17-14(19)11-9-12(15)18-13(10-11)16-4-2/h9-10H,3-8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | RYDJGMKOWYBOCN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|