C12H17ClN4O2 — CID 62175036
2-chloro-6-(ethylamino)-N-[3-(methylamino)-3-oxopropyl]pyridine-4-carboxamide (PubChem CID 62175036) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-chloro-6-(ethylamino)-N-[3-(methylamino)-3-oxopropyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(ethylamino)-N-[3-(methylamino)-3-oxopropyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62175036 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-chloro-6-(ethylamino)-N-[3-(methylamino)-3-oxopropyl]pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NCCC(=O)NC)cc(Cl)n1 |
| InChI | InChI=1S/C12H17ClN4O2/c1-3-15-10-7-8(6-9(13)17-10)12(19)16-5-4-11(18)14-2/h6-7H,3-5H2,1-2H3,(H,14,18)(H,15,17)(H,16,19) |
| InChIKey | UCNWOWUVIBWMQG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|