C13H20ClN3O — CID 62165976
2-chloro-6-(ethylamino)-N-(3-methylbutan-2-yl)pyridine-4-carboxamide (PubChem CID 62165976) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 2-chloro-6-(ethylamino)-N-(3-methylbutan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(ethylamino)-N-(3-methylbutan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62165976 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-chloro-6-(ethylamino)-N-(3-methylbutan-2-yl)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NC(C)C(C)C)cc(Cl)n1 |
| InChI | InChI=1S/C13H20ClN3O/c1-5-15-12-7-10(6-11(14)17-12)13(18)16-9(4)8(2)3/h6-9H,5H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | XMXBCTOUAZZLPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|