C14H15Cl2N3OS — CID 62180370
2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-6-(ethylamino)pyridine-4-carboxamide (PubChem CID 62180370) has the molecular formula C14H15Cl2N3OS and a molecular weight of 344.27 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-6-(ethylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-6-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62180370 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-chloro-N-[1-(5-chlorothiophen-2-yl)ethyl]-6-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NC(C)c2ccc(Cl)s2)cc(Cl)n1 |
| InChI | InChI=1S/C14H15Cl2N3OS/c1-3-17-13-7-9(6-11(15)19-13)14(20)18-8(2)10-4-5-12(16)21-10/h4-8H,3H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | QIMQNJZQRULMSO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|