C14H17ClN4OS — CID 115679300
2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-(methylamino)pyridine-4-carboxamide (PubChem CID 115679300) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115679300 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CCc1cnc(C(C)NC(=O)c2cc(Cl)nc(NC)c2)s1 |
| InChI | InChI=1S/C14H17ClN4OS/c1-4-10-7-17-14(21-10)8(2)18-13(20)9-5-11(15)19-12(6-9)16-3/h5-8H,4H2,1-3H3,(H,16,19)(H,18,20) |
| InChIKey | DNHNYPCWNGLYQQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|