C14H15ClN2OS2 — CID 107034319
2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-sulfanylbenzamide (PubChem CID 107034319) has the molecular formula C14H15ClN2OS2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107034319 |
| Molecular Formula | C14H15ClN2OS2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-chloro-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-sulfanylbenzamide |
| SMILES | CCc1cnc(C(C)NC(=O)c2cc(S)ccc2Cl)s1 |
| InChI | InChI=1S/C14H15ClN2OS2/c1-3-10-7-16-14(20-10)8(2)17-13(18)11-6-9(19)4-5-12(11)15/h4-8,19H,3H2,1-2H3,(H,17,18) |
| InChIKey | CGRGXKRGUWXTGH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|