C14H15FN2O2S — CID 115681963
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 115681963) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115681963 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | CCc1cnc(C(C)NC(=O)c2cc(F)ccc2O)s1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-3-10-7-16-14(20-10)8(2)17-13(19)11-6-9(15)4-5-12(11)18/h4-8,18H,3H2,1-2H3,(H,17,19) |
| InChIKey | QQKKEZOYBDDLTJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |