C14H13F3N2OS — CID 115679317
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3,4,5-trifluorobenzamide (PubChem CID 115679317) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 115679317 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3,4,5-trifluorobenzamide |
| SMILES | CCc1cnc(C(C)NC(=O)c2cc(F)c(F)c(F)c2)s1 |
| InChI | InChI=1S/C14H13F3N2OS/c1-3-9-6-18-14(21-9)7(2)19-13(20)8-4-10(15)12(17)11(16)5-8/h4-7H,3H2,1-2H3,(H,19,20) |
| InChIKey | CIBWRJAKNHUHLG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|