C14H14Br2N2OS — CID 103883113
2,4-dibromo-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 103883113) has the molecular formula C14H14Br2N2OS and a molecular weight of 418.15 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-dibromo-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103883113 |
| Molecular Formula | C14H14Br2N2OS |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | 2,4-dibromo-N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CCc1cnc(C(C)NC(=O)c2ccc(Br)cc2Br)s1 |
| InChI | InChI=1S/C14H14Br2N2OS/c1-3-10-7-17-14(20-10)8(2)18-13(19)11-5-4-9(15)6-12(11)16/h4-8H,3H2,1-2H3,(H,18,19) |
| InChIKey | XYAJJSCHBHFZFU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |