C11H15ClN4O2 — CID 62179327
N-(4-amino-4-oxobutyl)-2-chloro-6-(methylamino)pyridine-4-carboxamide (PubChem CID 62179327) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-2-chloro-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-2-chloro-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62179327 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-2-chloro-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NCCCC(N)=O)cc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN4O2/c1-14-10-6-7(5-8(12)16-10)11(18)15-4-2-3-9(13)17/h5-6H,2-4H2,1H3,(H2,13,17)(H,14,16)(H,15,18) |
| InChIKey | SQASVJQWAYDQBA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|