C12H16F2N4O2 — CID 63185740
3,5-difluoro-4-hydrazinyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 63185740) has the molecular formula C12H16F2N4O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 3,5-difluoro-4-hydrazinyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3,5-difluoro-4-hydrazinyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 63185740 |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3,5-difluoro-4-hydrazinyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NC(=O)CNC(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C12H16F2N4O2/c1-6(2)17-10(19)5-16-12(20)7-3-8(13)11(18-15)9(14)4-7/h3-4,6,18H,5,15H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | ADSQPXIRUXCRDU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|