C10H14F2N4O3S — CID 106340860
3,5-difluoro-4-hydrazinyl-N-[2-(methylsulfamoyl)ethyl]benzamide (PubChem CID 106340860) has the molecular formula C10H14F2N4O3S and a molecular weight of 308.31 g/mol. Its IUPAC name is 3,5-difluoro-4-hydrazinyl-N-[2-(methylsulfamoyl)ethyl]benzamide.
| Compound Name | 3,5-difluoro-4-hydrazinyl-N-[2-(methylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 106340860 |
| Molecular Formula | C10H14F2N4O3S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3,5-difluoro-4-hydrazinyl-N-[2-(methylsulfamoyl)ethyl]benzamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C10H14F2N4O3S/c1-14-20(18,19)3-2-15-10(17)6-4-7(11)9(16-13)8(12)5-6/h4-5,14,16H,2-3,13H2,1H3,(H,15,17) |
| InChIKey | HOSDNAXBWXEKCP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|