C14H20F2N2O2 — CID 82946466
3,5-difluoro-4-(methylamino)-N-(3-propoxypropyl)benzamide (PubChem CID 82946466) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3,5-difluoro-4-(methylamino)-N-(3-propoxypropyl)benzamide.
| Compound Name | 3,5-difluoro-4-(methylamino)-N-(3-propoxypropyl)benzamide |
|---|---|
| PubChem CID | 82946466 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3,5-difluoro-4-(methylamino)-N-(3-propoxypropyl)benzamide |
| SMILES | CCCOCCCNC(=O)c1cc(F)c(NC)c(F)c1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-6-20-7-4-5-18-14(19)10-8-11(15)13(17-2)12(16)9-10/h8-9,17H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | REVZNKGEFCPAFP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|